ethyl 6-(4-tert-butylphenyl)-4-oxo-3-phenyl-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Chemical Structure Depiction of
ethyl 6-(4-tert-butylphenyl)-4-oxo-3-phenyl-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
ethyl 6-(4-tert-butylphenyl)-4-oxo-3-phenyl-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | C276-0861 |
| Compound Name: | ethyl 6-(4-tert-butylphenyl)-4-oxo-3-phenyl-4,5,6,7-tetrahydro-1H-indole-2-carboxylate |
| Molecular Weight: | 415.53 |
| Molecular Formula: | C27 H29 N O3 |
| Smiles: | CCOC(c1c(c2ccccc2)c2C(CC(Cc2[nH]1)c1ccc(cc1)C(C)(C)C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.6205 |
| logD: | 6.6204 |
| logSw: | -5.8957 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.523 |
| InChI Key: | JBKQWUFQYAZPJT-LJQANCHMSA-N |