cyclohexylmethyl 2-methyl-4-(3-nitrophenyl)-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
Chemical Structure Depiction of
cyclohexylmethyl 2-methyl-4-(3-nitrophenyl)-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
cyclohexylmethyl 2-methyl-4-(3-nitrophenyl)-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
Compound characteristics
| Compound ID: | C276-1365 |
| Compound Name: | cyclohexylmethyl 2-methyl-4-(3-nitrophenyl)-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate |
| Molecular Weight: | 372.42 |
| Molecular Formula: | C20 H24 N2 O5 |
| Smiles: | CC1=C(C(CC(N1)=O)c1cccc(c1)[N+]([O-])=O)C(=O)OCC1CCCCC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6159 |
| logD: | 2.6759 |
| logSw: | -3.9654 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.87 |
| InChI Key: | RIZLPHTZNIBLJK-KRWDZBQOSA-N |