4-(2-chloro-5-nitrophenyl)-7-(2-chlorophenyl)-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
Chemical Structure Depiction of
4-(2-chloro-5-nitrophenyl)-7-(2-chlorophenyl)-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
4-(2-chloro-5-nitrophenyl)-7-(2-chlorophenyl)-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
Compound characteristics
| Compound ID: | C276-1478 |
| Compound Name: | 4-(2-chloro-5-nitrophenyl)-7-(2-chlorophenyl)-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione |
| Molecular Weight: | 431.27 |
| Molecular Formula: | C21 H16 Cl2 N2 O4 |
| Smiles: | C1C(CC(C2C(CC(NC1=2)=O)c1cc(ccc1[Cl])[N+]([O-])=O)=O)c1ccccc1[Cl] |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.7392 |
| logD: | 3.6283 |
| logSw: | -5.0492 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.116 |
| InChI Key: | HFPHKLUMSXQRCY-UHFFFAOYSA-N |