cyclooctyl 4-(2,6-dichlorophenyl)-2-methyl-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
Chemical Structure Depiction of
cyclooctyl 4-(2,6-dichlorophenyl)-2-methyl-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
cyclooctyl 4-(2,6-dichlorophenyl)-2-methyl-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
Compound characteristics
| Compound ID: | C276-1539 |
| Compound Name: | cyclooctyl 4-(2,6-dichlorophenyl)-2-methyl-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate |
| Molecular Weight: | 410.34 |
| Molecular Formula: | C21 H25 Cl2 N O3 |
| Smiles: | CC1=C(C(CC(N1)=O)c1c(cccc1[Cl])[Cl])C(=O)OC1CCCCCCC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.16 |
| logD: | 4.4938 |
| logSw: | -5.4447 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.854 |
| InChI Key: | NVELBNPHXCHEPE-HNNXBMFYSA-N |