7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
Chemical Structure Depiction of
7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
Compound characteristics
| Compound ID: | C276-1571 |
| Compound Name: | 7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione |
| Molecular Weight: | 393.44 |
| Molecular Formula: | C23 H23 N O5 |
| Smiles: | COc1ccc(cc1OC)C1CC2=C(C(CC(N2)=O)c2ccc(cc2)O)C(C1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.4352 |
| logD: | 1.1718 |
| logSw: | -2.899 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.613 |
| InChI Key: | RQIGPGJHYOPNFT-UHFFFAOYSA-N |