2-({N-[2-(3,4-dimethoxyphenyl)ethyl]glycyl}amino)-N-(2-fluorophenyl)-5-nitrobenzamide
Chemical Structure Depiction of
2-({N-[2-(3,4-dimethoxyphenyl)ethyl]glycyl}amino)-N-(2-fluorophenyl)-5-nitrobenzamide
2-({N-[2-(3,4-dimethoxyphenyl)ethyl]glycyl}amino)-N-(2-fluorophenyl)-5-nitrobenzamide
Compound characteristics
| Compound ID: | C284-0052 |
| Compound Name: | 2-({N-[2-(3,4-dimethoxyphenyl)ethyl]glycyl}amino)-N-(2-fluorophenyl)-5-nitrobenzamide |
| Molecular Weight: | 496.49 |
| Molecular Formula: | C25 H25 F N4 O6 |
| Smiles: | COc1ccc(CCNCC(Nc2ccc(cc2C(Nc2ccccc2F)=O)[N+]([O-])=O)=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 2.3065 |
| logD: | 2.1089 |
| logSw: | -3.2286 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 105.333 |
| InChI Key: | QKPITHYICVXJQL-UHFFFAOYSA-N |