ethyl 3~4~-ethyl-1~4~-fluoro-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate
Chemical Structure Depiction of
ethyl 3~4~-ethyl-1~4~-fluoro-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate
ethyl 3~4~-ethyl-1~4~-fluoro-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate
Compound characteristics
| Compound ID: | C288-0039 |
| Compound Name: | ethyl 3~4~-ethyl-1~4~-fluoro-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate |
| Molecular Weight: | 366.43 |
| Molecular Formula: | C23 H23 F O3 |
| Smiles: | CCc1ccc(cc1)C1CC(=CC(C1C(=O)OCC)=O)c1ccc(cc1)F |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.3675 |
| logD: | 5.3671 |
| logSw: | -5.3629 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 33.889 |
| InChI Key: | YPSULCXLWUIMKN-UHFFFAOYSA-N |