ethyl 4'-fluoro-3-(furan-2-yl)-5-oxo-2,3,4,5-tetrahydro[1,1'-biphenyl]-4-carboxylate
Chemical Structure Depiction of
ethyl 4'-fluoro-3-(furan-2-yl)-5-oxo-2,3,4,5-tetrahydro[1,1'-biphenyl]-4-carboxylate
ethyl 4'-fluoro-3-(furan-2-yl)-5-oxo-2,3,4,5-tetrahydro[1,1'-biphenyl]-4-carboxylate
Compound characteristics
| Compound ID: | C288-0048 |
| Compound Name: | ethyl 4'-fluoro-3-(furan-2-yl)-5-oxo-2,3,4,5-tetrahydro[1,1'-biphenyl]-4-carboxylate |
| Molecular Weight: | 328.34 |
| Molecular Formula: | C19 H17 F O4 |
| Smiles: | CCOC(C1C(CC(=CC1=O)c1ccc(cc1)F)c1ccco1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.5748 |
| logD: | 3.5746 |
| logSw: | -3.5895 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 42.467 |
| InChI Key: | XNXIPYJNNJMEHL-UHFFFAOYSA-N |