ethyl 5-(furan-2-yl)-2',5'-dimethoxy-3-oxo-1,2,3,6-tetrahydro[1,1'-biphenyl]-2-carboxylate
Chemical Structure Depiction of
ethyl 5-(furan-2-yl)-2',5'-dimethoxy-3-oxo-1,2,3,6-tetrahydro[1,1'-biphenyl]-2-carboxylate
ethyl 5-(furan-2-yl)-2',5'-dimethoxy-3-oxo-1,2,3,6-tetrahydro[1,1'-biphenyl]-2-carboxylate
Compound characteristics
| Compound ID: | C288-0122 |
| Compound Name: | ethyl 5-(furan-2-yl)-2',5'-dimethoxy-3-oxo-1,2,3,6-tetrahydro[1,1'-biphenyl]-2-carboxylate |
| Molecular Weight: | 370.4 |
| Molecular Formula: | C21 H22 O6 |
| Smiles: | CCOC(C1C(CC(=CC1=O)c1ccco1)c1cc(ccc1OC)OC)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.5262 |
| logD: | 3.526 |
| logSw: | -3.6257 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 57.642 |
| InChI Key: | LLOZZLVCMMMTEU-UHFFFAOYSA-N |