ethyl 1~3~,1~4~-dimethoxy-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate
					Chemical Structure Depiction of
ethyl 1~3~,1~4~-dimethoxy-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate
			ethyl 1~3~,1~4~-dimethoxy-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate
Compound characteristics
| Compound ID: | C288-0127 | 
| Compound Name: | ethyl 1~3~,1~4~-dimethoxy-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate | 
| Molecular Weight: | 380.44 | 
| Molecular Formula: | C23 H24 O5 | 
| Smiles: | CCOC(C1C(CC(=CC1=O)c1ccc(c(c1)OC)OC)c1ccccc1)=O | 
| Stereo: | MIXTURE OF STEREOISOMERS | 
| logP: | 3.8973 | 
| logD: | 3.8969 | 
| logSw: | -4.1388 | 
| Hydrogen bond acceptors count: | 7 | 
| Polar surface area: | 49.15 | 
| InChI Key: | QNPUHMAHUKIAGP-UHFFFAOYSA-N | 
 
				 
				