ethyl 3~2~-chloro-1~3~,1~4~-dimethoxy-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate
Chemical Structure Depiction of
ethyl 3~2~-chloro-1~3~,1~4~-dimethoxy-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate
ethyl 3~2~-chloro-1~3~,1~4~-dimethoxy-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate
Compound characteristics
| Compound ID: | C288-0146 |
| Compound Name: | ethyl 3~2~-chloro-1~3~,1~4~-dimethoxy-2~5~-oxo-2~2~,2~3~,2~4~,2~5~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~4~-carboxylate |
| Molecular Weight: | 414.88 |
| Molecular Formula: | C23 H23 Cl O5 |
| Smiles: | CCOC(C1C(CC(=CC1=O)c1ccc(c(c1)OC)OC)c1ccccc1[Cl])=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.4072 |
| logD: | 4.4069 |
| logSw: | -4.5517 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.15 |
| InChI Key: | QJSXAYJQAYXDTA-UHFFFAOYSA-N |