1-(2,3-dihydro-1H-indol-1-yl)-2-{[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}ethan-1-one
Chemical Structure Depiction of
1-(2,3-dihydro-1H-indol-1-yl)-2-{[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}ethan-1-one
1-(2,3-dihydro-1H-indol-1-yl)-2-{[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}ethan-1-one
Compound characteristics
| Compound ID: | C292-0110 |
| Compound Name: | 1-(2,3-dihydro-1H-indol-1-yl)-2-{[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}ethan-1-one |
| Molecular Weight: | 367.42 |
| Molecular Formula: | C19 H17 N3 O3 S |
| Smiles: | COc1cccc(c1)c1nnc(o1)SCC(N1CCc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1609 |
| logD: | 3.1609 |
| logSw: | -3.485 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 53.031 |
| InChI Key: | ICHMESKGJCCSCZ-UHFFFAOYSA-N |