2-{[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-1-(morpholin-4-yl)ethan-1-one
Chemical Structure Depiction of
2-{[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-1-(morpholin-4-yl)ethan-1-one
2-{[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-1-(morpholin-4-yl)ethan-1-one
Compound characteristics
| Compound ID: | C292-0285 |
| Compound Name: | 2-{[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-1-(morpholin-4-yl)ethan-1-one |
| Molecular Weight: | 361.46 |
| Molecular Formula: | C18 H23 N3 O3 S |
| Smiles: | CC(C)(C)c1ccc(cc1)c1nnc(o1)SCC(N1CCOCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9786 |
| logD: | 2.9786 |
| logSw: | -3.0271 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 54.365 |
| InChI Key: | FGPDVRZANNUASR-UHFFFAOYSA-N |