N-(3-chloro-4-methylphenyl)[1,2,4]triazolo[4,3-a]quinoxalin-4-amine
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)[1,2,4]triazolo[4,3-a]quinoxalin-4-amine
N-(3-chloro-4-methylphenyl)[1,2,4]triazolo[4,3-a]quinoxalin-4-amine
Compound characteristics
| Compound ID: | C301-1237 |
| Compound Name: | N-(3-chloro-4-methylphenyl)[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
| Molecular Weight: | 309.76 |
| Molecular Formula: | C16 H12 Cl N5 |
| Smiles: | Cc1ccc(cc1[Cl])Nc1c2nncn2c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 4.1311 |
| logD: | 4.1167 |
| logSw: | -4.259 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.078 |
| InChI Key: | KBPQGNZRNGHBIN-UHFFFAOYSA-N |