N-(2,5-dimethylphenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine
N-(2,5-dimethylphenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine
Compound characteristics
| Compound ID: | C301-2052 |
| Compound Name: | N-(2,5-dimethylphenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine |
| Molecular Weight: | 304.35 |
| Molecular Formula: | C17 H16 N6 |
| Smiles: | Cc1ccc(C)c(c1)Nc1c2nnnn2c2cc(C)ccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 3.6031 |
| logD: | 3.4766 |
| logSw: | -3.4668 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.679 |
| InChI Key: | LUOHQTRVRDWXGO-UHFFFAOYSA-N |