N-benzyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide
Chemical Structure Depiction of
N-benzyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide
N-benzyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide
Compound characteristics
| Compound ID: | C301-2639 |
| Compound Name: | N-benzyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
| Molecular Weight: | 279.3 |
| Molecular Formula: | C16 H13 N3 O2 |
| Smiles: | C(c1ccccc1)NC(c1nnc(c2ccccc2)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3628 |
| logD: | 2.3628 |
| logSw: | -2.6523 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.167 |
| InChI Key: | VALIGBIDFJQKHD-UHFFFAOYSA-N |