5-[(3,4-dimethoxyphenyl)methyl]-N-(2-methoxyethyl)-1,3,4-oxadiazole-2-carboxamide
Chemical Structure Depiction of
5-[(3,4-dimethoxyphenyl)methyl]-N-(2-methoxyethyl)-1,3,4-oxadiazole-2-carboxamide
5-[(3,4-dimethoxyphenyl)methyl]-N-(2-methoxyethyl)-1,3,4-oxadiazole-2-carboxamide
Compound characteristics
| Compound ID: | C301-2762 |
| Compound Name: | 5-[(3,4-dimethoxyphenyl)methyl]-N-(2-methoxyethyl)-1,3,4-oxadiazole-2-carboxamide |
| Molecular Weight: | 321.33 |
| Molecular Formula: | C15 H19 N3 O5 |
| Smiles: | COCCNC(c1nnc(Cc2ccc(c(c2)OC)OC)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 0.4973 |
| logD: | 0.4973 |
| logSw: | -1.9932 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.549 |
| InChI Key: | CGGLOQXUUUSGGK-UHFFFAOYSA-N |