{5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl}(morpholin-4-yl)methanone
Chemical Structure Depiction of
{5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl}(morpholin-4-yl)methanone
{5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl}(morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | C301-2779 |
| Compound Name: | {5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl}(morpholin-4-yl)methanone |
| Molecular Weight: | 307.73 |
| Molecular Formula: | C14 H14 Cl N3 O3 |
| Smiles: | C(c1cccc(c1)[Cl])c1nnc(C(N2CCOCC2)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 1.515 |
| logD: | 1.515 |
| logSw: | -2.2286 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.977 |
| InChI Key: | CBVZPJWVSGTGFR-UHFFFAOYSA-N |