N-cyclooctyl-5-[(2-methoxyphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide
Chemical Structure Depiction of
N-cyclooctyl-5-[(2-methoxyphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide
N-cyclooctyl-5-[(2-methoxyphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide
Compound characteristics
| Compound ID: | C301-2795 |
| Compound Name: | N-cyclooctyl-5-[(2-methoxyphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide |
| Molecular Weight: | 343.42 |
| Molecular Formula: | C19 H25 N3 O3 |
| Smiles: | COc1ccccc1Cc1nnc(C(NC2CCCCCCC2)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.8755 |
| logD: | 3.8755 |
| logSw: | -4.0733 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.52 |
| InChI Key: | LZBZJZOMTIXYMS-UHFFFAOYSA-N |