N-[2-(3,4-diethoxyphenyl)ethyl]-5-[(4-methylphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide
Chemical Structure Depiction of
N-[2-(3,4-diethoxyphenyl)ethyl]-5-[(4-methylphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide
N-[2-(3,4-diethoxyphenyl)ethyl]-5-[(4-methylphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide
Compound characteristics
| Compound ID: | C301-3221 |
| Compound Name: | N-[2-(3,4-diethoxyphenyl)ethyl]-5-[(4-methylphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide |
| Molecular Weight: | 409.48 |
| Molecular Formula: | C23 H27 N3 O4 |
| Smiles: | CCOc1ccc(CCNC(c2nnc(Cc3ccc(C)cc3)o2)=O)cc1OCC |
| Stereo: | ACHIRAL |
| logP: | 2.7511 |
| logD: | 2.7511 |
| logSw: | -3.0634 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.095 |
| InChI Key: | OTHOALOPUKIVDJ-UHFFFAOYSA-N |