[4-(5-chloro-2-methylphenyl)piperazin-1-yl][3-(5-methyl-2H-tetrazol-2-yl)adamantan-1-yl]methanone
Chemical Structure Depiction of
[4-(5-chloro-2-methylphenyl)piperazin-1-yl][3-(5-methyl-2H-tetrazol-2-yl)adamantan-1-yl]methanone
[4-(5-chloro-2-methylphenyl)piperazin-1-yl][3-(5-methyl-2H-tetrazol-2-yl)adamantan-1-yl]methanone
Compound characteristics
| Compound ID: | C301-3266 |
| Compound Name: | [4-(5-chloro-2-methylphenyl)piperazin-1-yl][3-(5-methyl-2H-tetrazol-2-yl)adamantan-1-yl]methanone |
| Molecular Weight: | 455 |
| Molecular Formula: | C24 H31 Cl N6 O |
| Smiles: | Cc1ccc(cc1N1CCN(CC1)C(C12CC3CC(C1)CC(C3)(C2)n1nc(C)nn1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.6735 |
| logD: | 4.6735 |
| logSw: | -4.741 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 57.055 |
| InChI Key: | BJYPEIWSZSDXTF-UHFFFAOYSA-N |