6,7-dichloro-3-(3,5-dimethyl-1H-pyrazol-1-yl)-N-(4-fluorophenyl)quinoxalin-2-amine
Chemical Structure Depiction of
6,7-dichloro-3-(3,5-dimethyl-1H-pyrazol-1-yl)-N-(4-fluorophenyl)quinoxalin-2-amine
6,7-dichloro-3-(3,5-dimethyl-1H-pyrazol-1-yl)-N-(4-fluorophenyl)quinoxalin-2-amine
Compound characteristics
| Compound ID: | C301-3755 |
| Compound Name: | 6,7-dichloro-3-(3,5-dimethyl-1H-pyrazol-1-yl)-N-(4-fluorophenyl)quinoxalin-2-amine |
| Molecular Weight: | 402.26 |
| Molecular Formula: | C19 H14 Cl2 F N5 |
| Smiles: | Cc1cc(C)n(c2c(Nc3ccc(cc3)F)nc3cc(c(cc3n2)[Cl])[Cl])n1 |
| Stereo: | ACHIRAL |
| logP: | 5.6178 |
| logD: | 5.6168 |
| logSw: | -6.0654 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.528 |
| InChI Key: | SZGFRWDWTOJGAT-UHFFFAOYSA-N |