6,7-dichloro-N-(2,4-dimethylphenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)quinoxalin-2-amine
Chemical Structure Depiction of
6,7-dichloro-N-(2,4-dimethylphenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)quinoxalin-2-amine
6,7-dichloro-N-(2,4-dimethylphenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)quinoxalin-2-amine
Compound characteristics
| Compound ID: | C301-3760 |
| Compound Name: | 6,7-dichloro-N-(2,4-dimethylphenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)quinoxalin-2-amine |
| Molecular Weight: | 412.32 |
| Molecular Formula: | C21 H19 Cl2 N5 |
| Smiles: | Cc1ccc(c(C)c1)Nc1c(nc2cc(c(cc2n1)[Cl])[Cl])n1c(C)cc(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.3882 |
| logD: | 6.3859 |
| logSw: | -6.4547 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.83 |
| InChI Key: | NUJSEUBOYZPVPZ-UHFFFAOYSA-N |