N-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine
Chemical Structure Depiction of
N-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine
N-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine
Compound characteristics
| Compound ID: | C301-4433 |
| Compound Name: | N-(4-chlorophenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine |
| Molecular Weight: | 310.74 |
| Molecular Formula: | C15 H11 Cl N6 |
| Smiles: | Cc1ccc2c(c1)n1c(c(Nc3ccc(cc3)[Cl])n2)nnn1 |
| Stereo: | ACHIRAL |
| logP: | 3.8398 |
| logD: | 3.8291 |
| logSw: | -4.2308 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.377 |
| InChI Key: | SJZDEAPHGCAQLD-UHFFFAOYSA-N |