2-(2-chlorophenyl)-5-(3-fluorophenyl)-1,3,4-oxadiazole
Chemical Structure Depiction of
2-(2-chlorophenyl)-5-(3-fluorophenyl)-1,3,4-oxadiazole
2-(2-chlorophenyl)-5-(3-fluorophenyl)-1,3,4-oxadiazole
Compound characteristics
| Compound ID: | C301-4787 |
| Compound Name: | 2-(2-chlorophenyl)-5-(3-fluorophenyl)-1,3,4-oxadiazole |
| Molecular Weight: | 274.68 |
| Molecular Formula: | C14 H8 Cl F N2 O |
| Smiles: | c1ccc(c(c1)c1nnc(c2cccc(c2)F)o1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.8225 |
| logD: | 3.8225 |
| logSw: | -4.4119 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 30.4825 |
| InChI Key: | HWYDXSOBYKSJHJ-UHFFFAOYSA-N |