2-(4-methoxyphenyl)-3-[4-(pyridin-2-yl)piperazin-1-yl]-1H-inden-1-one
Chemical Structure Depiction of
2-(4-methoxyphenyl)-3-[4-(pyridin-2-yl)piperazin-1-yl]-1H-inden-1-one
2-(4-methoxyphenyl)-3-[4-(pyridin-2-yl)piperazin-1-yl]-1H-inden-1-one
Compound characteristics
| Compound ID: | C301-5605 |
| Compound Name: | 2-(4-methoxyphenyl)-3-[4-(pyridin-2-yl)piperazin-1-yl]-1H-inden-1-one |
| Molecular Weight: | 397.48 |
| Molecular Formula: | C25 H23 N3 O2 |
| Smiles: | COc1ccc(cc1)C1=C(c2ccccc2C1=O)N1CCN(CC1)c1ccccn1 |
| Stereo: | ACHIRAL |
| logP: | 4.9174 |
| logD: | 4.9085 |
| logSw: | -4.5738 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.086 |
| InChI Key: | ITJOGFANNLOXOO-UHFFFAOYSA-N |