ethyl 2-{[(3-chlorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]amino}benzoate
Chemical Structure Depiction of
ethyl 2-{[(3-chlorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]amino}benzoate
ethyl 2-{[(3-chlorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]amino}benzoate
Compound characteristics
| Compound ID: | C301-5621 |
| Compound Name: | ethyl 2-{[(3-chlorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]amino}benzoate |
| Molecular Weight: | 433.89 |
| Molecular Formula: | C24 H20 Cl N3 O3 |
| Smiles: | CCOC(c1ccccc1NC(c1cccc(c1)[Cl])c1nnc(c2ccccc2)o1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.8282 |
| logD: | 5.8282 |
| logSw: | -5.9209 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.125 |
| InChI Key: | SXRTVBULVYLGQE-OAQYLSRUSA-N |