3-(5-chloro-2-methoxyanilino)-2-phenyl-1H-inden-1-one
Chemical Structure Depiction of
3-(5-chloro-2-methoxyanilino)-2-phenyl-1H-inden-1-one
3-(5-chloro-2-methoxyanilino)-2-phenyl-1H-inden-1-one
Compound characteristics
| Compound ID: | C301-5812 |
| Compound Name: | 3-(5-chloro-2-methoxyanilino)-2-phenyl-1H-inden-1-one |
| Molecular Weight: | 361.83 |
| Molecular Formula: | C22 H16 Cl N O2 |
| Smiles: | COc1ccc(cc1NC1=C(C(c2ccccc12)=O)c1ccccc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.3553 |
| logD: | 4.7508 |
| logSw: | -5.9819 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.4439 |
| InChI Key: | CZROSKCVKGPUBB-UHFFFAOYSA-N |