3-(3-fluoroanilino)-2-phenyl-1H-inden-1-one
Chemical Structure Depiction of
3-(3-fluoroanilino)-2-phenyl-1H-inden-1-one
3-(3-fluoroanilino)-2-phenyl-1H-inden-1-one
Compound characteristics
| Compound ID: | C301-5820 |
| Compound Name: | 3-(3-fluoroanilino)-2-phenyl-1H-inden-1-one |
| Molecular Weight: | 315.35 |
| Molecular Formula: | C21 H14 F N O |
| Smiles: | c1ccc(cc1)C1=C(c2ccccc2C1=O)Nc1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 4.9324 |
| logD: | 4.8877 |
| logSw: | -4.9302 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.5113 |
| InChI Key: | RWEAFXDOKRLCRB-UHFFFAOYSA-N |