3-chloro-N-[(4-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-4-methylaniline
Chemical Structure Depiction of
3-chloro-N-[(4-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-4-methylaniline
3-chloro-N-[(4-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-4-methylaniline
Compound characteristics
| Compound ID: | C301-5854 |
| Compound Name: | 3-chloro-N-[(4-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-4-methylaniline |
| Molecular Weight: | 393.85 |
| Molecular Formula: | C22 H17 Cl F N3 O |
| Smiles: | Cc1ccc(cc1[Cl])NC(c1ccc(cc1)F)c1nnc(c2ccccc2)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.0509 |
| logD: | 6.0509 |
| logSw: | -6.2138 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.069 |
| InChI Key: | NINMNESWBPXSBU-HXUWFJFHSA-N |