3-(3,5-dimethoxyanilino)-2-phenyl-1H-inden-1-one
Chemical Structure Depiction of
3-(3,5-dimethoxyanilino)-2-phenyl-1H-inden-1-one
3-(3,5-dimethoxyanilino)-2-phenyl-1H-inden-1-one
Compound characteristics
| Compound ID: | C301-5945 |
| Compound Name: | 3-(3,5-dimethoxyanilino)-2-phenyl-1H-inden-1-one |
| Molecular Weight: | 357.41 |
| Molecular Formula: | C23 H19 N O3 |
| Smiles: | COc1cc(cc(c1)OC)NC1=C(C(c2ccccc12)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.9181 |
| logD: | 4.8651 |
| logSw: | -4.7104 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.599 |
| InChI Key: | BSICKKYFCPTFRJ-UHFFFAOYSA-N |