3-(3-chloro-4-methylanilino)-2-phenyl-1H-inden-1-one
Chemical Structure Depiction of
3-(3-chloro-4-methylanilino)-2-phenyl-1H-inden-1-one
3-(3-chloro-4-methylanilino)-2-phenyl-1H-inden-1-one
Compound characteristics
| Compound ID: | C301-5956 |
| Compound Name: | 3-(3-chloro-4-methylanilino)-2-phenyl-1H-inden-1-one |
| Molecular Weight: | 345.83 |
| Molecular Formula: | C22 H16 Cl N O |
| Smiles: | Cc1ccc(cc1[Cl])NC1=C(C(c2ccccc12)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 6.1692 |
| logD: | 6.1111 |
| logSw: | -6.0186 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.5113 |
| InChI Key: | GLKGCIQOHNARFU-UHFFFAOYSA-N |