N-[(4-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]cyclohexanamine
Chemical Structure Depiction of
N-[(4-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]cyclohexanamine
N-[(4-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]cyclohexanamine
Compound characteristics
| Compound ID: | C301-6053 |
| Compound Name: | N-[(4-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]cyclohexanamine |
| Molecular Weight: | 351.42 |
| Molecular Formula: | C21 H22 F N3 O |
| Smiles: | C1CCC(CC1)NC(c1ccc(cc1)F)c1nnc(c2ccccc2)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8959 |
| logD: | 4.8925 |
| logSw: | -4.7859 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.117 |
| InChI Key: | UBYDNAUFEACREV-LJQANCHMSA-N |