4-bromo-N-{(4-chlorophenyl)[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-3-methylaniline
Chemical Structure Depiction of
4-bromo-N-{(4-chlorophenyl)[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-3-methylaniline
4-bromo-N-{(4-chlorophenyl)[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-3-methylaniline
Compound characteristics
| Compound ID: | C301-6316 |
| Compound Name: | 4-bromo-N-{(4-chlorophenyl)[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-3-methylaniline |
| Molecular Weight: | 472.74 |
| Molecular Formula: | C22 H16 Br Cl F N3 O |
| Smiles: | Cc1cc(ccc1[Br])NC(c1ccc(cc1)[Cl])c1nnc(c2cccc(c2)F)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.5485 |
| logD: | 6.5485 |
| logSw: | -6.6765 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.069 |
| InChI Key: | KSPCBQLCUHSSHZ-HXUWFJFHSA-N |