4-chloro-N-(1,4,7-trimethyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-6-yl)benzamide
Chemical Structure Depiction of
4-chloro-N-(1,4,7-trimethyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-6-yl)benzamide
4-chloro-N-(1,4,7-trimethyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-6-yl)benzamide
Compound characteristics
| Compound ID: | C301-6495 |
| Compound Name: | 4-chloro-N-(1,4,7-trimethyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-6-yl)benzamide |
| Molecular Weight: | 357.79 |
| Molecular Formula: | C18 H16 Cl N3 O3 |
| Smiles: | Cc1cc2c(cc1NC(c1ccc(cc1)[Cl])=O)N(C)C(C(N2C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2003 |
| logD: | 2.1926 |
| logSw: | -3.319 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.991 |
| InChI Key: | OYQUJWQXCSOMNK-UHFFFAOYSA-N |