6-ethyl-5-methyl-N-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
6-ethyl-5-methyl-N-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
6-ethyl-5-methyl-N-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | C301-7521 |
| Compound Name: | 6-ethyl-5-methyl-N-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 267.33 |
| Molecular Formula: | C15 H17 N5 |
| Smiles: | CCc1c(C)nc2ncnn2c1Nc1ccc(C)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3247 |
| logD: | 3.3173 |
| logSw: | -3.476 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.901 |
| InChI Key: | FQQOLUSPMUDQDV-UHFFFAOYSA-N |