6-methyl-N,9-bis[3-(trifluoromethyl)phenyl]-9H-purin-2-amine
Chemical Structure Depiction of
6-methyl-N,9-bis[3-(trifluoromethyl)phenyl]-9H-purin-2-amine
6-methyl-N,9-bis[3-(trifluoromethyl)phenyl]-9H-purin-2-amine
Compound characteristics
| Compound ID: | C301-7541 |
| Compound Name: | 6-methyl-N,9-bis[3-(trifluoromethyl)phenyl]-9H-purin-2-amine |
| Molecular Weight: | 437.35 |
| Molecular Formula: | C20 H13 F6 N5 |
| Smiles: | Cc1c2c(nc(Nc3cccc(c3)C(F)(F)F)n1)n(cn2)c1cccc(c1)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 5.9279 |
| logD: | 5.9273 |
| logSw: | -5.9911 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.706 |
| InChI Key: | BRXCVXHEYCRGOL-UHFFFAOYSA-N |