6-ethyl-N-(2-methoxy-5-methylphenyl)-5-methyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
6-ethyl-N-(2-methoxy-5-methylphenyl)-5-methyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
6-ethyl-N-(2-methoxy-5-methylphenyl)-5-methyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | C301-7643 |
| Compound Name: | 6-ethyl-N-(2-methoxy-5-methylphenyl)-5-methyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 373.46 |
| Molecular Formula: | C22 H23 N5 O |
| Smiles: | CCc1c(C)nc2nc(c3ccccc3)nn2c1Nc1cc(C)ccc1OC |
| Stereo: | ACHIRAL |
| logP: | 5.006 |
| logD: | 4.9458 |
| logSw: | -4.6779 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.621 |
| InChI Key: | VICORCPHSRZQHO-UHFFFAOYSA-N |