N-(5-chloro-2-methoxyphenyl)-6-ethyl-5-methyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
N-(5-chloro-2-methoxyphenyl)-6-ethyl-5-methyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
N-(5-chloro-2-methoxyphenyl)-6-ethyl-5-methyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | C301-7673 |
| Compound Name: | N-(5-chloro-2-methoxyphenyl)-6-ethyl-5-methyl-2-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 393.87 |
| Molecular Formula: | C21 H20 Cl N5 O |
| Smiles: | CCc1c(C)nc2nc(c3ccccc3)nn2c1Nc1cc(ccc1OC)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.422 |
| logD: | 5.3618 |
| logSw: | -5.9617 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.621 |
| InChI Key: | QFSGZWWRAODZDL-UHFFFAOYSA-N |