N,3-bis(4-fluorophenyl)-7-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-5-amine
Chemical Structure Depiction of
N,3-bis(4-fluorophenyl)-7-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-5-amine
N,3-bis(4-fluorophenyl)-7-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-5-amine
Compound characteristics
| Compound ID: | C301-7700 |
| Compound Name: | N,3-bis(4-fluorophenyl)-7-methyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-5-amine |
| Molecular Weight: | 338.32 |
| Molecular Formula: | C17 H12 F2 N6 |
| Smiles: | Cc1c2c(nc(Nc3ccc(cc3)F)n1)n(c1ccc(cc1)F)nn2 |
| Stereo: | ACHIRAL |
| logP: | 3.7773 |
| logD: | 3.7773 |
| logSw: | -4.1074 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.625 |
| InChI Key: | XCHLRBXBVPYFDN-UHFFFAOYSA-N |