N-[4-(benzyloxy)phenyl]-3-chloroquinoxaline-2-carboxamide
Chemical Structure Depiction of
N-[4-(benzyloxy)phenyl]-3-chloroquinoxaline-2-carboxamide
N-[4-(benzyloxy)phenyl]-3-chloroquinoxaline-2-carboxamide
Compound characteristics
| Compound ID: | C301-8274 |
| Compound Name: | N-[4-(benzyloxy)phenyl]-3-chloroquinoxaline-2-carboxamide |
| Molecular Weight: | 389.84 |
| Molecular Formula: | C22 H16 Cl N3 O2 |
| Smiles: | C(c1ccccc1)Oc1ccc(cc1)NC(c1c(nc2ccccc2n1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.9853 |
| logD: | 4.9821 |
| logSw: | -5.0838 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.898 |
| InChI Key: | MEMLBHIMMYJHNN-UHFFFAOYSA-N |