N-(3-chloro-4-methoxyphenyl)-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxamide
N-(3-chloro-4-methoxyphenyl)-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxamide
Compound characteristics
| Compound ID: | C301-8477 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxamide |
| Molecular Weight: | 343.77 |
| Molecular Formula: | C17 H14 Cl N3 O3 |
| Smiles: | CN1C(C(C(Nc2ccc(c(c2)[Cl])OC)=O)=Nc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4349 |
| logD: | 2.3637 |
| logSw: | -3.3485 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.209 |
| InChI Key: | OFLVSPUTWJQLGZ-UHFFFAOYSA-N |