4-methoxy-N-{6-[(4-methoxyphenyl)sulfanyl]-1,3-dimethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl}benzene-1-sulfonamide
Chemical Structure Depiction of
4-methoxy-N-{6-[(4-methoxyphenyl)sulfanyl]-1,3-dimethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl}benzene-1-sulfonamide
4-methoxy-N-{6-[(4-methoxyphenyl)sulfanyl]-1,3-dimethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | C301-9213 |
| Compound Name: | 4-methoxy-N-{6-[(4-methoxyphenyl)sulfanyl]-1,3-dimethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl}benzene-1-sulfonamide |
| Molecular Weight: | 485.58 |
| Molecular Formula: | C23 H23 N3 O5 S2 |
| Smiles: | CN1C(N(C)c2cc(c(cc12)NS(c1ccc(cc1)OC)(=O)=O)Sc1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6447 |
| logD: | 4.6436 |
| logSw: | -4.4545 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.691 |
| InChI Key: | KXDCBGAIFZCIPW-UHFFFAOYSA-N |