N-{2-[(1-benzyl-3-chloro-1H-1,2,4-triazol-5-yl)sulfanyl]phenyl}-3-fluorobenzamide
Chemical Structure Depiction of
N-{2-[(1-benzyl-3-chloro-1H-1,2,4-triazol-5-yl)sulfanyl]phenyl}-3-fluorobenzamide
N-{2-[(1-benzyl-3-chloro-1H-1,2,4-triazol-5-yl)sulfanyl]phenyl}-3-fluorobenzamide
Compound characteristics
| Compound ID: | C301-9346 |
| Compound Name: | N-{2-[(1-benzyl-3-chloro-1H-1,2,4-triazol-5-yl)sulfanyl]phenyl}-3-fluorobenzamide |
| Molecular Weight: | 438.91 |
| Molecular Formula: | C22 H16 Cl F N4 O S |
| Smiles: | C(c1ccccc1)n1c(nc(n1)[Cl])Sc1ccccc1NC(c1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1777 |
| logD: | 5.1777 |
| logSw: | -5.7394 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.462 |
| InChI Key: | YKPBPJWWJQYSDX-UHFFFAOYSA-N |