N-{4-[(3-amino-1,4-dioxo-1,4-dihydronaphthalen-2-yl)sulfanyl]phenyl}-N'-(3-methoxyphenyl)urea
Chemical Structure Depiction of
N-{4-[(3-amino-1,4-dioxo-1,4-dihydronaphthalen-2-yl)sulfanyl]phenyl}-N'-(3-methoxyphenyl)urea
N-{4-[(3-amino-1,4-dioxo-1,4-dihydronaphthalen-2-yl)sulfanyl]phenyl}-N'-(3-methoxyphenyl)urea
Compound characteristics
| Compound ID: | C301-9693 |
| Compound Name: | N-{4-[(3-amino-1,4-dioxo-1,4-dihydronaphthalen-2-yl)sulfanyl]phenyl}-N'-(3-methoxyphenyl)urea |
| Molecular Weight: | 445.5 |
| Molecular Formula: | C24 H19 N3 O4 S |
| Smiles: | COc1cccc(c1)NC(Nc1ccc(cc1)SC1=C(C(c2ccccc2C1=O)=O)N)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7834 |
| logD: | 4.7833 |
| logSw: | -4.7764 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 87.134 |
| InChI Key: | VKSGEOUUYYTSGL-UHFFFAOYSA-N |