ethyl 4-[(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene)acetyl]piperazine-1-carboxylate
Chemical Structure Depiction of
ethyl 4-[(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene)acetyl]piperazine-1-carboxylate
ethyl 4-[(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene)acetyl]piperazine-1-carboxylate
Compound characteristics
| Compound ID: | C306-0565 |
| Compound Name: | ethyl 4-[(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene)acetyl]piperazine-1-carboxylate |
| Molecular Weight: | 361.42 |
| Molecular Formula: | C17 H19 N3 O4 S |
| Smiles: | CCOC(N1CCN(CC1)C(/C=C1/C(Nc2ccccc2S1)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.728 |
| logD: | 1.728 |
| logSw: | -2.4092 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.017 |
| InChI Key: | AHRPYGPCMTYGJN-UHFFFAOYSA-N |