2-{2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethylidene}-2H-1,4-benzothiazin-3(4H)-one
Chemical Structure Depiction of
2-{2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethylidene}-2H-1,4-benzothiazin-3(4H)-one
2-{2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethylidene}-2H-1,4-benzothiazin-3(4H)-one
Compound characteristics
| Compound ID: | C306-0573 |
| Compound Name: | 2-{2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethylidene}-2H-1,4-benzothiazin-3(4H)-one |
| Molecular Weight: | 399.9 |
| Molecular Formula: | C20 H18 Cl N3 O2 S |
| Smiles: | C1CN(CCN1C(/C=C1/C(Nc2ccccc2S1)=O)=O)c1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.4092 |
| logD: | 3.4092 |
| logSw: | -3.8221 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.497 |
| InChI Key: | IHHJJPCVMJXTAE-UHFFFAOYSA-N |