2-[(2-chlorophenyl)methylidene]-6-[4-(4-fluorophenyl)piperazine-1-carbonyl]-4-methyl-2H-1,4-benzothiazin-3(4H)-one
Chemical Structure Depiction of
2-[(2-chlorophenyl)methylidene]-6-[4-(4-fluorophenyl)piperazine-1-carbonyl]-4-methyl-2H-1,4-benzothiazin-3(4H)-one
2-[(2-chlorophenyl)methylidene]-6-[4-(4-fluorophenyl)piperazine-1-carbonyl]-4-methyl-2H-1,4-benzothiazin-3(4H)-one
Compound characteristics
| Compound ID: | C310-2499 |
| Compound Name: | 2-[(2-chlorophenyl)methylidene]-6-[4-(4-fluorophenyl)piperazine-1-carbonyl]-4-methyl-2H-1,4-benzothiazin-3(4H)-one |
| Molecular Weight: | 508.01 |
| Molecular Formula: | C27 H23 Cl F N3 O2 S |
| Smiles: | CN1C(/C(=C/c2ccccc2[Cl])Sc2ccc(cc12)C(N1CCN(CC1)c1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.071 |
| logD: | 5.071 |
| logSw: | -5.3655 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 35.015 |
| InChI Key: | FEXKCZGOEREGBD-UHFFFAOYSA-N |