2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-N-[(thiophen-2-yl)methyl]-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide
Chemical Structure Depiction of
2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-N-[(thiophen-2-yl)methyl]-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide
2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-N-[(thiophen-2-yl)methyl]-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide
Compound characteristics
| Compound ID: | C310-2549 |
| Compound Name: | 2-[(2-chlorophenyl)methylidene]-4-methyl-3-oxo-N-[(thiophen-2-yl)methyl]-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide |
| Molecular Weight: | 440.97 |
| Molecular Formula: | C22 H17 Cl N2 O2 S2 |
| Smiles: | CN1C(/C(=C/c2ccccc2[Cl])Sc2ccc(cc12)C(NCc1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.929 |
| logD: | 4.929 |
| logSw: | -4.9523 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.539 |
| InChI Key: | IHAPYUBCSBLESE-UHFFFAOYSA-N |