2-{2-[(2-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}-N-(3-ethoxypropyl)acetamide
Chemical Structure Depiction of
2-{2-[(2-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}-N-(3-ethoxypropyl)acetamide
2-{2-[(2-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}-N-(3-ethoxypropyl)acetamide
Compound characteristics
| Compound ID: | C311-0940 |
| Compound Name: | 2-{2-[(2-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}-N-(3-ethoxypropyl)acetamide |
| Molecular Weight: | 414.89 |
| Molecular Formula: | C22 H23 Cl N2 O4 |
| Smiles: | CCOCCCNC(CN1C(/C(=C\c2ccccc2[Cl])Oc2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3404 |
| logD: | 3.3404 |
| logSw: | -3.73 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.595 |
| InChI Key: | JQPDGMRUPBXGRF-UHFFFAOYSA-N |